| Identification | |
| Name: | 4-Heptanol,2,6-dimethyl- |
| Synonyms: | 2,6-Dimethyl-4-heptanol;2,6-Dimethyl-4-heptyl alcohol;Diisobutylcarbinol;NSC 62683; |
| CAS: | 108-82-7 |
| EINECS: | 203-619-6 |
| Molecular Formula: | C9H20 O |
| Molecular Weight: | 144.29 |
| InChI: | InChI=1/C9H20O/c1-7(2)5-9(10)6-8(3)4/h7-10H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -65 |
| Flash Point: | 66 ºC |
| Boiling Point: | 177.2-180 ºC |
| Density: | 0.809 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4227-1.4247 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear liquid |
| Specification: | clear liquid Safety Statements:26-36/37/39-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes |
| Packinggroup: | I; II; III |
| Flash Point: | 66 ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | COLORLESS LIQUID |
| Usage: | As solvent for coating compositions of urea or melamine resins & for prepn of lubricant additives & plasticizers. |
| Safety Data | |
 |
|
