| Identification | |
| Name: | isobutyl vinyl ether |
| Synonyms: | vinyl isobutyl ether; 1-(ethenyloxy)-2-methyl-propane |
| CAS: | 109-53-5 |
| EINECS: | 203-678-8 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-4-7-5-6(2)3/h4,6H,1,5H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1304 |
| Density: | 0.769 |
| Stability: | Polymerizes easily. |
| Refractive index: | 1.394-1.396 |
| Solubility: | Insoluble (soluble in alcohol and ether) AUTOIGNITION |
| Appearance: | clear colourless liquid |
| Specification: |
??Propane,1-(ethenyloxy)-2-methyl- ,?its cas register number is 64058-30-6. It also can be called?2-Methyl-1-vinyloxypropane ; 4-01-00-02054 (Beilstein Handbook Reference) ; AI3-18425 ; IVE ; Isobutanol vinyl ether ; Isobutoxyethene ; Isobutyl vinyl ether ; Lutanol LR 8500 ; NSC 8265 ; Vinyl isobutyl ether .? |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
