| Identification | |
| Name: | N,N-Dimethyl-1,3-propane diamine |
| Synonyms: | N,N-Dimethyl-1,3-propanediamine; 3-aminopropyldimethylamine; 3-Dimethylaminopopylamine; N,N-Dimethyl-1,3-propandiamine; N,N-dimethyl-1,3-propanediamine; 3-Dimethylaminopropyl Amine |
| CAS: | 109-55-7 |
| EINECS: | 203-680-9 |
| Molecular Formula: | C5H14N2 |
| Molecular Weight: | 102.18 |
| InChI: | InChI=1/C5H14N2/c1-7(2)5-3-4-6/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Density: | 0.81 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.434-1.436 |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | Colorless liquid |
| Specification: |
? 3-Dimethylaminopropylamine , with CAS number of 109-55-7, can be called 1,3-Propanediamine,N,N-dimethyl- (6CI,8CI,9CI) ; (3-Aminopropyl)dimethylamine ; (3-Dimethylaminopropan-1-yl)amine ; 3-(Dimethylamino)propylamine ; N,N-Dimethyl-3-aminopropylamine ; N,N-Dimethyl-N-(3-aminopropyl)amine ; N',N'-Dimethylpropane-1,3-diamine ; g-Dimethylaminopropylamine . It is a?clear liquid, 3-Dimethylaminopropylamine (CAS NO.109-55-7) is incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides and acid halides. Flammable gaseous hydrogen may be generated in combination with strong reducing agents, such as hydrides. |
| Packinggroup: | II |
| HS Code: | 29212900 |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Usage: | Used as a chemical intermediate in the synthesis of basic blue 22. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
