| Identification | |
| Name: | Ethanol,2-[(1-methylethyl)amino]- |
| Synonyms: | Ethanol,2-(isopropylamino)- (6CI,7CI,8CI); 2-(Isopropylamino)ethanol;2-(Monoisopropylamino)ethanol; 2-(N-Isopropylamino)ethanol;2-[(1-Methylethyl)amino]ethanol; N-(2-Hydroxyethyl)isopropylamine;N-(Hydroxyethyl)isopropylamine; N-Isopropyl-2-hydroxyethylamine;N-Isopropylaminoethanol; N-Isopropylethanolamine; NSC 1090; NSC 128124 |
| CAS: | 109-56-8 |
| EINECS: | 203-681-4 |
| Molecular Formula: | C5H13 N O |
| Molecular Weight: | 103.19 |
| InChI: | InChI=1/C5H13NO/c1-4(2)6-5(3)7/h4-7H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Flash Point: | 70.3°C |
| Boiling Point: | 170.4°Cat760mmHg |
| Density: | 0.875g/cm3 |
| Refractive index: | n20/D 1.441(lit.) |
| Specification: |
N-isopropylaminoethanol (109-56-8) is an amber to straw colored liquid. Slightly less dense than water. Flash point 150°F. May emit toxic oxides of nitrogen at high temperatures. Used to make other chemicals. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 70.3°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
