| Identification | |
| Name: | Allylthiourea |
| Synonyms: | Thiourea,2-propenyl- (9CI);Urea, 1-allyl-2-thio- (8CI);1-Allylthiourea;2-Propenylthiourea;Allylthiocarbamide;1-Allyl-2-thiourea;Aminosin;N-Allylthiourea;NSC 1915;Rhodallin;Rhodalline;Thiosinamin;Thiosinamine;U 19571; |
| CAS: | 109-57-9 |
| EINECS: | 203-683-5 |
| Molecular Formula: | C4H8N2S |
| Molecular Weight: | 116.20 |
| InChI: | InChI=1S/C4H8N2S/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 70-72 ºC |
| Flash Point: | 69.5ºC |
| Boiling Point: | 191.3 ºC at 760 mmHg |
| Density: | 1.084 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5936 (78 C) |
| Water Solubility: | 67 G/L (20 ºC) |
| Solubility: | 67 g/L (20 ºC) |
| Appearance: | white crystals or powder |
| Specification: | white crystals or powder Safety Statements:45-24/25 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Flash Point: | 69.5ºC |
| Storage Temperature: | Keep containers tightly closed. Store in a cool, dry area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
