| Identification | |
| Name: | 2-isopropoxyethanol |
| Synonyms: | Isopropyl glycol |
| CAS: | 109-59-1 |
| EINECS: | 203-685-6 |
| Molecular Formula: | C5H12O2 |
| Molecular Weight: | 104.15 |
| InChI: | InChI=1/C5H12O2/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 |
| Density: | 0.903 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.41 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Combustible. Toxicology Harmful if inhaled or absorbed through the skin.Eye irritant. Typical OEL 22 mg/m3. Toxicity |
| Solubility: |
|
| Appearance: | clear colorless liquid |
| Specification: | colourless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
