| Identification | |
| Name: | n-Propyl acetate |
| Synonyms: | Acetic acid n-propyl ester; N-BUTYLE BROMURE; Propyl Acetate |
| CAS: | 109-60-4 |
| EINECS: | 203-686-1 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1276 |
| Density: | 0.888 |
| Stability: | Stable. Highly flammable. May react violently with oxidizing agents. May form explosive mixtures with air. Incompatible with strong oxidizing agents, acids, bases. |
| Refractive index: | 1.383-1.385 |
| Solubility: | 2g/100 mL (20 oC) |
| Appearance: | colourless liquid with a strong odour |
| Specification: |
? ?n-Propyl acetate (CAS No.109-60-4), it also can be called Propyl acetate ; Acetic acid propyl ester . It is colourless liquid with a strong odour. It is an ester, highly flammable liquid, moderately toxic. Dangerous fire hazard when exposed to heat, flame, sparks, or strong oxidizers. When heated to decomposition Propyl acetate emits acrid smoke and irritating fumes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
