| Identification | |
| Name: | 1H-1-Benzazepine-1-aceticacid, 3-amino-2,3,4,5-tetrahydro-2-oxo-, 1,1-dimethylethyl ester, (3S)- |
| Synonyms: | (S)-1-[(tert-Butyloxycarbonyl)methyl]-3-amino-2,3,4,5-tetrahydro-1H-[1]benzazepin-2-one;(S)-1,1-Dimethylethyl3-amino-2-oxo-2,3,4,5-tetrahydro-1H-benz[b]azepin-1-acetate;1H-1-Benzazepine-1-aceticacid, 3-amino-2,3,4,5-tetrahydro-2-oxo-, 1,1-dimethylethyl ester, (S)-; |
| CAS: | 109010-60-8 |
| Molecular Formula: | C16H22N2O3 |
| Molecular Weight: | 290.36 |
| InChI: | InChI=1/C16H23N3O2/c1-11(2)9-18-15(20)10-19-14-6-4-3-5-12(14)7-8-13(17)16(19)21/h3-6,11,13H,7-10,17H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| Molecular Structure: | ![(C16H22N2O3) (S)-1-[(tert-Butyloxycarbonyl)methyl]-3-amino-2,3,4,5-tetrahydro-1H-[1]benzazepin-2-one;(S)-1,1-Dime...](https://img.guidechem.com/casimg/109010-60-8.gif) |
| Properties | |
| Flash Point: | 246 ºC |
| Boiling Point: | 483.2 ºC at 760 mmHg |
| Density: | 1.133 g/cm3 |
| Refractive index: | 1.543 |
| Alpha: | -270 º (C=0.5, ETOH) |
| Water Solubility: | DMSO: ~34 mg/mL, soluble |
| Solubility: | DMSO: ~34 mg/mL, soluble |
| Appearance: | Off-White Solid |
| Specification: |
S-ATBA , its cas register number is 109010-60-8. It also can be called (S)-3-Amino-2,3,4,5-tetrahydro-2-oxo-1H-1-benazepine-1-acetic acid 1,1-dimethyl ethyl ester ; and tert-Butyl-3-amino-2,3,4,5-tetrahydro-2-oxo-1H-(3S)-benzazepine-1-acetate . |
| Flash Point: | 246 ºC |
| Color: | white |
| Usage: | An intermediate in the synthesis of benazepril |
| Safety Data | |
 |
|
