| Identification | |
| Name: | 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid |
| Synonyms: | Hydrocinnamicacid, 2-methoxy-5-methyl-b-phenyl- (6CI); |
| CAS: | 109089-77-2 |
| Molecular Formula: | C17H18O3 |
| Molecular Weight: | 270.32 |
| InChI: | InChI=1/C17H18O3/c1-12-8-9-16(20-2)15(10-12)14(11-17(18)19)13-6-4-3-5-7-13/h3-10,14H,11H2,1-2H3,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.138 g/cm3 |
| Refractive index: | 1.569 |
| Appearance: | white crystalline solid |
| Specification: |
3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid , with CAS number of 109089-77-2, can be called benzenepropanoic acid, 2-methoxy-5-methyl-beta-phenyl- ; 2-Methoxy-5-Methyl-beta-Phenylbenzene Propanoic Acid . It is a white crystalline solid. |
| Safety Data | |
 |
|
