| Identification |
| Name: | Benzenebutanoic acid, a-hydroxy-, phenylmethyl ester |
| Synonyms: | Benzyl 2-hydroxy-4-phenylbutyrate;Phenyl-methyl -hydroxybenzenebutanoate |
| CAS: | 109684-03-9 |
| Molecular Formula: | C17H18 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H18O3/c18-16(12-11-14-7-3-1-4-8-14)17(19)20-13-15-9-5-2-6-10-15/h1-10,16,18H,11-13H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 177.2°C |
| Boiling Point: | 426.9°C at 760 mmHg |
| Density: | 1.156g/cm3 |
| Refractive index: | 1.576 |
| Flash Point: | 177.2°C |
| Usage: | An intermediate in the preparation of Benazepril metabolites |
| Safety Data |
| |
 |
