| Identification | |
| Name: | Isopropyl myristate |
| Synonyms: | Bisomel;Stepan D-50;propan-2-yl tetradecanoate;Tegester;Kessco isopropyl myristate;Emerest 2314;Myristic acid, isopropyl ester;IPM-R;Plymoutm IPM;iso-Propyl Myristate;Isopropyl myristate (NF);Ja-fa IPM;1-Tridecanecarboxylic acid, isopropyl ester;Estol IPM 1512;Isopropyl tetradecanoate;Tetradecanoic acid, isopropyl ester;Tetradecanoic acid,esters,1-methylethyl ester;Estergel (TN);component of Sardo Bath Oil;Wickenol 101;Estergel;Unimate IPM;Sinnoester MIP;Kesscomir;Isomyst;Tetradecanoic acid, isopropyl;Promyr;Isopropylmyristate;Myristic acid isopropyl ester; |
| CAS: | 110-27-0 |
| EINECS: | 203-751-4 |
| Molecular Formula: | C17H34O2 |
| Molecular Weight: | 270.45 |
| InChI: | InChI=1/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3/h16H,4-15H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 29.6 dyne/cm Density: 0.864 g/cm3 |
| Density: | 0.853 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.434-1.436 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | colourless to pale yellow, odourless liquid |
| Specification: | colourless liquid of low viscosity Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | I; II; III |
| HS Code: | 29159080 |
| Flash Point: | 29.6 dyne/cm Density: 0.864 g/cm3 |
| Color: | Liquid of low viscosity Colorless oil |
| Usage: | In cosmetic and topical medicinal preparations. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
