| Identification |
| Name: | Hexanedioic acid,1,6-dihexyl ester |
| Synonyms: | Adipicacid, dihexyl ester (6CI,7CI,8CI); Hexanedioic acid, dihexyl ester (9CI);Dihexyl adipate; Dihexyl hexanedioate; Plastomoll DHA |
| CAS: | 110-33-8 |
| EINECS: | 203-757-7 |
| Molecular Formula: | C18H34 O4 |
| Molecular Weight: | 314.46 |
| InChI: | InChI=1/C18H34O4/c1-3-5-7-11-15-21-17(19)13-9-10-14-18(20)22-16-12-8-6-4-2/h3-16H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.945 g/cm3 |
| Refractive index: | 1.447 |
| Appearance: | white crystal powder |
| Specification: |
Hexanedioic acid dihexyl ester (110-33-8) is a colorless liquid.It can floats on water.
Reactivity Profile: It is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides.
Health Hazard: Exposure can cause irritation of eyes, nose and throat.
Fire Hazard: Special Hazards of Combustion Products: Irritating vapors and toxic gases, such as carbon dioxide and carbon monoxide, may be formed when involved in fire.
|
| Report: |
Reported in EPA TSCA Inventory.
|
| Safety Data |
| |
 |