| Identification | |
| Name: | Undecanal, 2-methyl- |
| Synonyms: | 2-Methyl-1-undecanal;2-Methylundecanal; Aldehyde M.N.A.; Methyl n-nonyl acetaldehyde;Methylnonylacetaldehyde; NSC 46127 |
| CAS: | 110-41-8 |
| EINECS: | 203-765-0 |
| Molecular Formula: | C12H24 O |
| Molecular Weight: | 184.32 |
| InChI: | InChI=1/C12H24O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h11-12H,3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.829 |
| Refractive index: | 1.432 |
| Appearance: | slightly yellow |
| Specification: |
It smells herbaceous, orange, and ambergris-like. At high dilution it has a flavor similar to honey and nuts. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
