| Identification | |
| Name: | Diisopropanolamine |
| Synonyms: | Bis(2-hydroxypropyl)amine; 1,1'-Iminodi-2-propanol |
| CAS: | 110-97-4 |
| EINECS: | 203-820-9 |
| Molecular Formula: | C6H15NO2 |
| Molecular Weight: | 133.19 |
| InChI: | InChI=1/C6H15NO2/c1-5(8)3-7-4-6(2)9/h5-9H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 190kgs |
| Density: | 1.0038 |
| Refractive index: | 1.4615-1.4635 |
| Solubility: | soluble SOLVENT |
| Appearance: | clear to yellow solid |
| Specification: |
Reactivity Profile : Diisopropanolamine is an aminoalcohol. Amines are chemical bases. They neutralize acids to form salts plus water. These acid-base reactions are exothermic. The amount of heat that is evolved per mole of amine in a neutralization is largely independent of the strength of the amine as a base. Amines may be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen is generated by amines in combination with strong reducing agents, such as hydrides. Diisopropanolamine may be sensitive to light and air. Diisopropanolamine will react with oxidizing materials
|
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive & Hygroscopic |
| Color: | White waxy solid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
