Identification |
Name: | 1,2,4-Benzenetricarboxylicacid, mixed cyclohexyl and hexyl esters |
Synonyms: | 110475-01-9;AC1L3BA8;1,2,4-Benzenetricarboxylic acid, mixed cyclohexyl and hexyl esters;2,4-dicyclohexyl 1-hexyl benzene-1,2,4-tricarboxylate;2-O,4-O-dicyclohexyl 1-O-hexyl benzene-1,2,4-tricarboxylate |
CAS: | 110475-01-9 |
Molecular Formula: | C27H38O6 |
Molecular Weight: | 458.587 |
InChI: | InChI=1/C27H38O6/c1-2-3-4-11-18-31-26(29)23-17-16-20(25(28)32-21-12-7-5-8-13-21)19-24(23)27(30)33-22-14-9-6-10-15-22/h16-17,19,21-22H,2-15,18H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 230.1°C |
Boiling Point: | 544.9°C at 760 mmHg |
Density: | 1.13g/cm3 |
Refractive index: | 1.533 |
Flash Point: | 230.1°C |
Safety Data |
|
 |