| Identification | |
| Name: | Heptanoic acid |
| Synonyms: | Enanthic acid; Oenanthic acid; Enanthoic Acid |
| CAS: | 111-14-8 |
| EINECS: | 203-838-7 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.18 |
| InChI: | InChI=1/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Flash Point: | 99.2 oC |
| Density: | 0.918 |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases, reducing agents. Combustible. Protect from light. |
| Refractive index: | 1.4214-1.4234 |
| Solubility: | 0.24 g/100 mL (15 oC) in water |
| Appearance: | clear to light yellow liquid |
| Specification: |
?Heptanoic acid (CAS NO.111-14-8), its Synonyms are 1-Hexanecarboxylic acid ; Enanthic acid ; Enanthylic acid ; Heptoic acid ; Heptylic acid ; Oenanthic acid ; Oenanthylic acid ; N-Heptanoic acid . It is colourless liquid with a pungent and rancid odour. It contributes to the odor of some rancid oils. It is slightly soluble in water, but very soluble in ethanol and ether. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 99.2 oC |
| Color: | CLEAR OILY LIQUID |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
