| Identification | |
| Name: | 3,3'-thiodi(propionic acid) |
| Synonyms: | 3,3'-Thiodipropionic acid |
| CAS: | 111-17-1 |
| EINECS: | 203-841-3 |
| Molecular Formula: | C6H10O4S |
| Molecular Weight: | 178.2 |
| InChI: | InChI=1/C6H10O4S/c7-5(8)1-3-11-4-2-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | 409.3°Cat760mmHg |
| Density: | 1.362g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Soluble in hot water (soluble in acetone, and alcohol) AUTOIGNITION |
| Appearance: | white crystalline powder |
| Specification: | WHITE FINE CRYSTALLINE POWDER Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29309070 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | NACREOUS LEAFLETS FROM HOT WATER |
| Usage: | Antioxidant for soap products & polymers of ethylene, in plasticizers and lubricants. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
