| Identification | |
| Name: | Octadecanamide,N-(2-hydroxyethyl)- |
| Synonyms: | Monoethanolstearamide;N-(2-Hydroxyethyl)octadecanamide;N-(2-Hydroxyethyl)stearamide;N-Octadecanoylethanolamine;N-Stearoylethanolamine;NSC 3377;Stearic ethanolamide;Stearicethylolamide;Stearic monoethanolamide;Stearic monoethanolamine;Stearoylmonoethanolamide; |
| CAS: | 111-57-9 |
| EINECS: | 203-883-2 |
| Molecular Formula: | C20H41NO2 |
| Molecular Weight: | 327.55 |
| InChI: | InChI=1/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h22H,2-19H2,1H3,(H,21,23) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 247.7°C |
| Boiling Point: | 486°Cat760mmHg |
| Density: | 0.904g/cm3 |
| Refractive index: | 1.463 |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 247.7°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
