| Identification | |
| Name: | Octadecanoic acid,ethyl ester |
| Synonyms: | Stearicacid, ethyl ester (6CI,8CI); Ethyl n-octadecanoate; Ethyl octadecanoate; Ethylstearate; KAK-ES; NSC 8919 |
| CAS: | 111-61-5 |
| EINECS: | 203-887-4 |
| Molecular Formula: | C20H40 O2 |
| Molecular Weight: | 312.5348 |
| InChI: | InChI=1/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h3-19H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.862g/cm3 |
| Refractive index: | 1.445 |
| Specification: | white crystalline mass usageEng:A fatty acid ester component of volatile oil from Rhododendron anthopogonoides; shows antimicrobial activity. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Usage: | A fatty acid ester component of volatile oil from Rhododendron anthopogonoides; shows antimicrobial activity. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
