| Identification | |
| Name: | 10-Undecenoic acid,methyl ester |
| Synonyms: | 10-Hendecenoicacid methyl ester;Maskod MNS 01-10;Methyl 10-undecenoate;Methyl10-undecylenate;Methyl undec-10-enylate;Methyl undecenoate;NSC 1273;Undecylenic acid methyl ester; |
| CAS: | 111-81-9 |
| EINECS: | 203-910-8 |
| Molecular Formula: | C12H22O2 |
| Molecular Weight: | 198.3019 |
| InChI: | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3H,1,4-11H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 99.3°C |
| Density: | 0.88g/cm3 |
| Refractive index: | n20/D 1.437(lit.) |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 99.3°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
