Identification |
Name: | Carbamic acid, ammoniumsalt (1:1) |
Synonyms: | Ammoniumcarbamate (6CI,7CI);Carbamic acid, monoammonium salt (8CI,9CI); |
CAS: | 1111-78-0 |
EINECS: | 214-185-2 |
Molecular Formula: | CH3NO2.H3N |
Molecular Weight: | 78.0706 |
InChI: | InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
Molecular Structure: |
|
Properties |
Density: | 1,6 g/cm3 |
Stability: | Stable, but may be moisture sensitive. Incompatible with strong oxidizing agents, strong acids, strong bases. |
Water Solubility: | Stability Stable, but may be moisture sensitive. Incompatible withstrong oxidizing agents, strong acids, strong bases. Toxicology Harmful if swallowed. Toxicity data |
Solubility: | |
Appearance: | solid |
Storage Temperature: | 2-8°C |
Safety Data |
|
|