| Identification | |
| Name: | Pebulate (Butylethylcarbamothioic acid S-propyl ester) |
| Synonyms: | Carbamic acid,butylethylthio-, S-propyl ester (6CI,8CI); Carbamothioic acid, butylethyl-,S-propyl ester (9CI); Butylethylthiocarbamic acid S-propyl ester; PEBC;Pebulate; R 2061; S-Propyl butylethylthiocarbamate;S-Propyl-N-butyl-N-ethylthiocarbamate; S-Propyl-N-ethyl-N-butylthiocarbamate;Stauffer 2061; Stauffer R 2061; Tillam |
| CAS: | 1114-71-2 |
| EINECS: | 214-215-4 |
| Molecular Formula: | C10H21 N O S |
| Molecular Weight: | 203.38 |
| InChI: | InChI=1/C10H21NOS/c1-4-7-8-11(6-3)10(12)13-9-5-2/h4-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3082 9/PG 3 |
| Density: | 0.959 g/cm3 |
| Refractive index: | 1.479 |
| Solubility: | Very soluble in acetone, benzene, methanol Soluble in xylene Miscible with acetone, benzene, isopropanol, methanol and xylene. In water, 100 mg/L at 25 deg C Miscible with kerosene, methylisobutyl ketone, 4-methylpentan-2-one |
| Specification: |
S-Propyl butylethylthiocarbamate ,its cas register number is 1114-71-2. It also can be called Tillam ; Carbamothioic acid, butylethyl-, S-propyl ester (9CI) ; Stauffer 2061 ; Propyl Ethyl-n-butylthiolcarbamate and Butyl(éthyl)thiocarbamate de S-propyle . |
| Storage Temperature: | 0-6°C |
| Color: | Colorless or yellow liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
