| Identification | |
| Name: | Zileuton |
| Synonyms: | A64077;Abbott 64077;Leutrol;N-(1-Benzo[b]thien-2-ylethyl)-N-hydroxyurea;Urea,N-(1-benzo[b]thien-2-ylethyl)-N-hydroxy-;Zyflo; |
| CAS: | 111406-87-2 |
| Molecular Formula: | C11H12N2O2S |
| Molecular Weight: | 236.29 |
| InChI: | InChI=1/C11H12N2O2S/c1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h2-7,15H,1H3,(H2,12,14) |
| Molecular Structure: | ![(C11H12N2O2S) A64077;Abbott 64077;Leutrol;N-(1-Benzo[b]thien-2-ylethyl)-N-hydroxyurea;Urea,N-(1-benzo[b]thien-2-yl...](https://img.guidechem.com/casimg/111406-87-2.gif) |
| Properties | |
| Flash Point: | 225.6 oC |
| Boiling Point: | 449.4 oC at 760 mmHg |
| Density: | 1.401 g/cm3 |
| Refractive index: | 1.704 |
| Solubility: | Insoluble |
| Appearance: | crystalline solid |
| Specification: |
?Zileuton (CAS NO.111406-87-2) is also named as (+-)-1-(1-Benzo(b)thien-2-ylethyl)-1-hydroxyurea ; A 64077 ; Abbott 64077 ; Leutrol ; N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea ; UNII-V1L22WVE2S ; Urea, N-(1-benzo(b)thien-2-ylethyl)-N-hydroxy-, (+-)- ; Zileutonum ; Zileutonum [INN-Latin] ; Zyflo ; Zyflo CR . |
| Flash Point: | 225.6 oC |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | An inhibitor of 5-lipoxygenase, the initial enzyme in the biosynthesis of leukotrienes from Arachidonic Acid. Used as an antiasthmatic |
| Safety Data | |
 |
|
