| Identification |
| Name: | 1,2-Octanediol |
| Synonyms: | 1,2-Dihydroxyoctane;1,2-Octylene glycol;7,8-Dihydroxyoctane;Caprylyl glycol;Dermosoft Octiol;LexGard O;NSC 71546;n-Octane-1,2-diol; |
| CAS: | 1117-86-8 |
| EINECS: | 214-254-7 |
| Molecular Formula: | C8H18O2 |
| Molecular Weight: | 146.23 |
| InChI: | InChI=1/C8H18O2/c1-2-3-4-5-6-8(10)7-9/h8-10H,2-7H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.914 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.452 |
| Solubility: | 3 g/L (20 ºC) |
| Appearance: | Colorless to white powder and chunks. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
