| Identification | |
| Name: | Dimethyl glutarate |
| Synonyms: | Glutaricacid, dimethyl ester (6CI,7CI,8CI);Pentanedioic acid, dimethyl ester (9CI);DBE 5;Dimethyl 1,3-propanedicarboxylate;Pentanedioic acid,1,5-dimethyl ester;Dimethylpentanedioate;Methyl glutarate;NSC 58578; |
| CAS: | 1119-40-0 |
| EINECS: | 214-277-2 |
| Molecular Formula: | C7H12O4 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C7H12O4/c1-10-6(8)4-3-5-7(9)11-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.087 |
| Stability: | Stable. Combustible. Incompatible with acids, bases, reducing agents, oxidizing agents. |
| Refractive index: | 1.4236-1.4256 |
| Water Solubility: | 53 g/L |
| Solubility: | 53 g/L in water |
| Appearance: | colorless clear liquid. |
| Specification: |
Dimethyl glutarate , its cas register number is 1119-40-0. It also can be called Dimethyl pentanedioate ; Glutaric acid, dimethyl ester ; Pentanedioic acid, dimethyl ester ; Glutaric acid, dimethyl ester (8CI) ; Pentanedioic acid, 1,5-dimethyl ester . |
| HS Code: | 29171990 |
| Storage Temperature: | 2-8°C |
| Color: | LIQUID |
| Usage: | Chemical intermediate for epichlorohydrin-polyamide resins for paper. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
