Identification |
Name: | Quetiapine |
Synonyms: | 2-(2-(4-Dibenzo(b,f)(1,4)thiazepin-11-yl-1-piperazinyl)ethoxy)ethanol;Co-Quetiapine;Seroquel;Ethanol,2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazinyl)ethoxy]-; |
CAS: | 111974-69-7 |
Molecular Formula: | C21H25N3O2S |
Molecular Weight: | 383.5071 |
InChI: | InChI=1S/C21H25N3O2S/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21/h1-8,25H,9-16H2 |
Molecular Structure: |
 |
Properties |
Transport: | HAZARD |
Melting Point: | 172 - 174 C |
Density: | 1.27 g/cm3 |
Water Solubility: | Soluble |
Solubility: | Soluble Appearance:white to off-white crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. |
Appearance: | white to off-white crystalline powder |
Color: | Solid |
Safety Data |
Hazard Symbols |
|
|
 |