| Identification |
| Name: | Decanoyl chloride |
| Synonyms: | capryl chloride |
| CAS: | 112-13-0 |
| EINECS: | 203-938-0 |
| Molecular Formula: | C10H19ClO |
| Molecular Weight: | 190.71 |
| InChI: | InChI=1/C10H19ClO/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 0.919 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.44-1.442 |
| Solubility: | Decomposes |
| Appearance: | Clear to slightly greyish liquid |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
