| Identification | |
| Name: | Acetic acid octyl ester |
| Synonyms: | Octylalcohol acetate (6CI);1-Acetoxyoctane;1-Octanol acetate;1-Octyl acetate;Acetic acid octanyl ester;Caprylyl acetate;NSC 67348;n-Octylacetate; |
| CAS: | 112-14-1 |
| EINECS: | 203-939-6 |
| Molecular Formula: | C10H20O2 |
| Molecular Weight: | 172.27 |
| InChI: | InChI=1/C10H20O2/c1-3-4-5-6-7-8-9-12-10(2)11/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.868 |
| Stability: | No data. |
| Refractive index: | 1.4175-1.4195 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Colorless liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | Z01 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
