| Identification |
| Name: | Undecanoic acid |
| Synonyms: | 1-Decanecarboxylic acid |
| CAS: | 112-37-8 |
| EINECS: | 203-964-2 |
| Molecular Formula: | C11H22O2 |
| Molecular Weight: | 186.29 |
| InChI: | InChI=1/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.909 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.418 (70 C) |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | colourless to light yellow liquid or solid |
| HS Code: | 29159080 |
| Storage Temperature: | 2-8°C |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
