| Identification | |
| Name: | Hexadecanoic acid,methyl ester |
| Synonyms: | Palmiticacid, methyl ester (6CI,8CI);Emery 2216;Metholene 2216;Methyl hexadecanoate;Methyl n-hexadecanoate;Methyl palmitate;NSC 4197;Pastell M 16;Uniphat A60;n-Hexadecanoic acid methyl ester; |
| CAS: | 112-39-0 |
| EINECS: | 203-966-3 |
| Molecular Formula: | C17H34O2 |
| Molecular Weight: | 270.45 |
| InChI: | InChI=1/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.852 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.4512(lit.) |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble in water |
| Appearance: | Colorless solid. |
| Specification: | Clear colorless liquid or low melting solid Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | 2-8°C |
| Color: | Colorless liq |
| Usage: | Intermediate for detergents, emulsifiers, wetting agents, stabilizers, resins, lubricants, plasticizers, animal feeds, medical research. |
| Safety Data | |
 |
|
