| Identification |
| Name: | 9-Octadecenoic acid(9Z)-, methyl ester |
| Synonyms: | 9-Octadecenoicacid (Z)-, methyl ester;Oleic acid, methyl ester (6CI,8CI);(Z)-9-Octadecenoicacid methyl ester;ADJ 100;Agnique ME 181U;Agrique ME 181-1;CE 1897;Carolube 1885;Edenor Me 90/95V;Edenor MeTiO5;Emerest 2801;Emery 2301;Esterol 112;Exceparl M-OL;Methyl (Z)-9-octadecenoate;Methylcis-9-octadecenoate;Nissan Unister M 182A;Pastel M 181;Phytorob926-67;Priolube 1400;Priolube 1403;Radia 7060;Synative ES-ME-V;Unister M182A;Witconol 2301;cis-9-Octadecenoic acid, methyl ester; |
| CAS: | 112-62-9 |
| EINECS: | 203-992-5 |
| Molecular Formula: | C19H36O2 |
| Molecular Weight: | 296.49 |
| InChI: | InChI=1/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10- |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1206 3/PG 2 |
| Density: | 0.87 |
| Stability: | Stable, but air and light sensitive. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.451-1.458 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | light yellow clear liquid. |
| HS Code: | 29161500 |
| Storage Temperature: | −20°C |
| Color: | Colorless to amber clear liquid |
| Usage: | Intermediate for detergents, emulsifiers, wetting agents, stabilizers, textiles treatment, plasticizers for duplicating inks, rubbers, waxes, chromatographic reference standard. |
| Safety Data |
| |
 |
