| Identification | |
| Name: | 9-Octadecenoylchloride, (9Z)- |
| Synonyms: | 9-(Z)-Octadecen-1-oyl chloride;(Z)-9-Octadecenoyl chloride;Oleic acid chloride;Oleic chloride;Oleylchloride;cis-9-Octadecenoyl chloride;9-Octadecenoylchloride, (Z)-;Oleoyl chloride (6CI,7CI,8CI); |
| CAS: | 112-77-6 |
| EINECS: | 204-005-0 |
| Molecular Formula: | C18H33ClO |
| Molecular Weight: | 300.911 |
| InChI: | InChI=1/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3/b10-9- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Refractive index: | n20/D 1.463(lit.) |
| Specification: | BROWN LIQUID Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
