| Identification | |
| Name: | Docosanoic acid |
| Synonyms: | Glycon B 70;Hydrofol Acid 560;NAA 222S;NAA 22S;NSC 32364;Prifac 2987;n-Docosanoic acid;Edenor C 22-85R;Edenor C22-85RGS;Hydrofol 2022-55;EXL 5;1-Docosanoicacid;B 95;B 95 (acid);Behenic acid; |
| CAS: | 112-85-6 |
| EINECS: | 204-010-8 |
| Molecular Formula: | C22H44O2 |
| Molecular Weight: | 340.58 |
| InChI: | InChI=1/C22H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-21H2,1H3,(H,23,24) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 0.881 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.427 (20 C) |
| Water Solubility: | 0.016 mg/L in water |
| Solubility: | 0.016 mg/L in water |
| Appearance: | white to cream crystals or powder |
| Specification: |
Behenic acid (CAS NO.112-85-6) is also named as 1-Docosanoic acid ; AI3-52709 ; Docosanoic acid ; Docosoic acid ; Glycon B-70 ; HSDB 5578 ; Hydrofol 2022-55 ; Hydrofol Acid 560 ; NSC 32364 ; UNII-H390488X0A ; n-Docosanoic acid . Behenic acid (CAS NO.112-85-6) is white to cream crystals or powder. It is stable and combustible. It is incompatible with bases, oxidizing agents, reducing agents. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Color: | Waxy solid Needles |
| Usage: | In cosmetics, waxes, plasticizers, chemicals, stabilizers. |
| Safety Data | |
 |
|
