| Identification | |
| Name: | Naratriptan |
| Synonyms: | N-Methyl-2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethanesulfonamide; |
| CAS: | 112111-49-6 |
| Molecular Formula: | C15H15NO2S |
| Molecular Weight: | 273.3501 |
| InChI: | InChI=1S/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17) |
| Molecular Structure: | ![(C15H15NO2S) N-Methyl-2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethanesulfonamide;](https://img1.guidechem.com/chem/e/dict/159/112111-49-6.jpg) |
| Properties | |
| Melting Point: | 164-166 deg C |
| Flash Point: | 292°C |
| Boiling Point: | 559.1°Cat760mmHg |
| Density: | 1.283g/cm3 |
| Solubility: | Practically insoluble in water and cyclohexane. Sparingly to slightly soluble in methanol and acetone. In water, 170.1 mg/L at 25 deg C (est) |
| Flash Point: | 292°C |
| Color: | White to off-white crystalline powder |
| Safety Data | |
 |
|
