Identification |
Name: | Pentanedioic acid,di-C6-10-branched and linear alkyl esters |
Synonyms: | 112400-77-8;AC1L3AYH;Pentanedioic acid, di-C6-10-branched and linear alkyl esters;2-ethylbutyl 2-methylpentyl pentanedioate;5-O-(2-ethylbutyl) 1-O-(2-methylpentyl) pentanedioate |
CAS: | 112400-77-8 |
Molecular Formula: | C17H32O4 |
Molecular Weight: | 300.4336 |
InChI: | InChI=1/C17H32O4/c1-5-9-14(4)12-20-16(18)10-8-11-17(19)21-13-15(6-2)7-3/h14-15H,5-13H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 140.9°C |
Boiling Point: | 321.3°C at 760 mmHg |
Density: | 0.948g/cm3 |
Refractive index: | 1.444 |
Flash Point: | 140.9°C |
Safety Data |
|
 |