| Identification |
| Name: | 5-Aminoisoquinoline |
| Synonyms: | isoquinol-5-ylamine |
| CAS: | 1125-60-6 |
| EINECS: | 214-408-3 |
| Molecular Formula: | C9H8N2 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C9H8N2/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-6H,10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Flash Point: | 183.3°C |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.673 |
| Water Solubility: | Soluble
AUTOIGNITION |
| Solubility: | Soluble
AUTOIGNITION
|
| Appearance: | yellow to brown crystalline powder |
| Packinggroup: | III |
| Flash Point: | 183.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
