| Identification | |
| Name: | Benzenemethanamine,4-bromo-2-fluoro- |
| Synonyms: | 1-(4-Bromo-2-fluorophenyl)methanamine;4-Bromo-2-fluorobenzylamine; [(4-Bromo-2-fluorophenyl)methyl]amine |
| CAS: | 112734-22-2 |
| Molecular Formula: | C7H7 Br F N |
| Molecular Weight: | 204.04 |
| InChI: | InChI=1/C7H7BrFN.ClH/c8-6-2-1-5(4-10)7(9)3-6;/h1-3H,4,10H2;1H |
| Molecular Structure: | ![(C7H7BrFN) 1-(4-Bromo-2-fluorophenyl)methanamine;4-Bromo-2-fluorobenzylamine; [(4-Bromo-2-fluorophenyl)methyl]a...](https://img.guidechem.com/casimg/112734-22-2.gif) |
| Properties | |
| Flash Point: | 125.7°C |
| Boiling Point: | 284.3°Cat760mmHg |
| Density: | 1.487g/cm3 |
| Specification: |
2-Fluoro-4-bromobenzyl amine , with CAS number of 112734-22-2, can be called Rarechem al bw 0772 ; Timtec-bb sbb005778 ; 4-Bromo-2-fluorobenzylamine ; 2-Fluoro-4-bromobenzyl amine ; 2-Fluoro-4-Bromobenzylamine HCl ; 4-Bromo-2-fluorobenzylamine,99% . 2-Fluoro-4-bromobenzyl amine (CAS NO.112734-22-2) is a clear colorless to slightly yellow liquid. |
| Flash Point: | 125.7°C |
| Safety Data | |
| Hazard Symbols |
C,Xi:Irritant
|
 |
|
