| Identification | |
| Name: | Benzoic acid, 4-cyano-,methyl ester |
| Synonyms: | Benzoicacid, p-cyano-, methyl ester (6CI,7CI,8CI);4-(Methoxycarbonyl)benzonitrile;4-cyanobenzoic acid methyl ester;Methylp-cyanobenzoate;p-Cyanobenzoic acid methyl ester; |
| CAS: | 1129-35-7 |
| EINECS: | 214-443-4 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Density: | 1.18 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | white crystal |
| Specification: |
Methyl 4-cyanobenzoate , its cas register number is 1129-35-7. It also can be called Benzoic acid, 4-cyano-, methyl ester ; and 4-Cyanobenzoic acid methyl ester . |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
