| Identification | |
| Name: | Sodium pyruvate |
| Synonyms: | Propanoicacid, 2-oxo-, sodium salt (9CI);Pyruvic acid, sodium salt (7CI,8CI);Sodiumpyruvate;Sodium a-ketopropionate; |
| CAS: | 113-24-6 |
| EINECS: | 204-024-4 |
| Molecular Formula: | C3H3NaO3 |
| Molecular Weight: | 110.04389 |
| InChI: | InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.267g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1,426-1,43 |
| Water Solubility: | H2O: 100 mg/mL |
| Solubility: | H2O: 100 mg/mL |
| Appearance: | White to slightly yellow crystalline powder |
| Specification: | White to slightly yellow crystalline pow Safety Statements:37/39-26-24/25-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29183000 |
| Usage: | Added to cell culture media as an additional source of energy. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
