| Identification | |
| Name: | MGK 264 |
| Synonyms: | N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide; MGK 264 (TM); 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro-4,7-Methano-1H-isoindole-1,3(2H)-dione; Carboximide; MGK-264; N-Octylbicycloheptenedicarboximide; Octacide 264; Octyl bicycloheptene dicarboximide; Synergist 264; Van Dyk 264 |
| CAS: | 113-48-4 |
| EINECS: | 204-029-1 |
| Molecular Formula: | C17H25NO2 |
| Molecular Weight: | 275.39 |
| InChI: | InChI=1/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | <-20 |
| Density: | 1.085 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.506 (20 C) |
| Solubility: | practically insoluble |
| Appearance: | colourless or light yellow liquid |
| Specification: |
4,7-Methano-1H-isoindole-1,3(2H)-dione,2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro- , its CAS NO. is 113-48-4, the synonyms are n-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide ; Mgk 264 (tm) ; Octacide 264(r) ; n-[2-Ethylhexyl]bicyclo-[2.2.1]-5-heptene-2,3-dicarboximide ; Mgk 264 ; n-(2-Ethylhexyl)-3,6-methano-1,2,3,6-tetrahydrophthalimide . |
| Storage Temperature: | 0-6°C |
| Color: | Very light, yellow colored liquid |
| Usage: | Synergist for pyrethroids in aerosol sprays for household and veterinary use. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
