| Identification | |
| Name: | 1H-Pyrazol-5-amine,3-methyl-1-phenyl- |
| Synonyms: | Pyrazole,5-amino-3-methyl-1-phenyl- (6CI,7CI,8CI);1-Phenyl-3-methyl-5-aminopyrazole;3-Amino-5-methyl-2-phenyl-2H-pyrazole;3-Methyl-1-phenyl-1H-pyrazol-5-amine;3-Methyl-1-phenyl-5-pyrazolamine;3-Methyl-1-phenylpyrazol-5-amine;5-Methyl-2-phenyl-2H-pyrazol-3-ylamine; |
| CAS: | 1131-18-6 |
| EINECS: | 214-463-3 |
| Molecular Formula: | C10H11N3 |
| Molecular Weight: | 173.21 |
| InChI: | InChI=1/C10H11N3/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-7H,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.2ºC |
| Boiling Point: | 333 ºC at 760 mmHg |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.624 |
| Specification: |
1-Phenyl-3-methyl-5-aminopyrazole ,its cas register number is 1131-18-6. It also can be called 3-Methyl-1-phenyl-1H-pyrazol-5-amine ; and 1H-Pyrazol-5-amine, 3-methyl-1-phenyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 155.2ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
