| Identification | |
| Name: | diphenyl selenide |
| Synonyms: | Phenylselenide (6CI,7CI,8CI); 1,1'-Selenobis[benzene]; Diphenyl selenide;Diphenylselenium; NSC 49758 |
| CAS: | 1132-39-4 |
| EINECS: | 214-474-3 |
| Molecular Formula: | C12H10Se |
| Molecular Weight: | 233.17 |
| InChI: | InChI=1S/C12H10Se/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: | ![(C12H10Se) Phenylselenide (6CI,7CI,8CI); 1,1'-Selenobis[benzene]; Diphenyl selenide;Diphenylselenium; NSC 49758](https://img.guidechem.com/crawlimg/1132-39-4.jpg) |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Melting Point: | 3°C |
| Flash Point: | >230 °F |
| Boiling Point: | 115-117 °C(lit.) |
| Density: | 1.338 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.6465(lit.) |
| Report: |
Selenium and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | >230 °F |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
