| Identification |
| Name: | L-Lysine,N2,N2-bis(carboxymethyl)- |
| Synonyms: | 13: PN:US20080160089 PAGE: 30 claimed sequence; 1: PN: US20050123932 PAGE: 1 claimedprotein; 4: PN: WO2004072260 PAGE: 12 claimed protein; 53: PN: WO2004025259PAGE: 47 claimed protein; AB-NTA; Lysine-N,N-diacetic acid;N-(5-Amino-1-carboxypentyl)iminodiacetic acid;N2,N2-Bis(carboxymethyl)-L-lysine |
| CAS: | 113231-05-3 |
| Molecular Formula: | C10H18 N2 O6 |
| Molecular Weight: | 262.26 |
| InChI: | InChI=1/C10H18N2O6/c11-4-2-1-3-7(10(17)18)12(5-8(13)14)6-9(15)16/h7H,1-6,11H2,(H,13,14)(H,15,16)(H,17,18)/t7-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 537.8 °C at 760 mmHg |
| Flash Point: | 279°C |
| Boiling Point: | 537.8°C at 760 mmHg |
| Density: | 1.389g/cm3 |
| Refractive index: | 1.551 |
| Flash Point: | 279°C |
| Usage: | A nitrilotriacetic acid derivative used as a metal chelating adsorbent for metal ion affinity chromatography. This method can be used for identification and rapid one-step purification of gene products expressed as fusion proteins with an oligo-histidine |
| Safety Data |
| |
 |