| Identification |
| Name: | 5-Methyl-3-phenylisoxazole-4-carboxylic acid |
| Synonyms: | 3-Phenyl-5-methylisoxazole-4-carboxylicacid;4-Carboxy-5-methyl-3-phenylisoxazole;NSC 76870; |
| CAS: | 1136-45-4 |
| EINECS: | 214-497-9 |
| Molecular Formula: | C11H9NO3 |
| Molecular Weight: | 203.2 |
| InChI: | InChI=1/C11H9NO3/c1-7-9(11(13)14)10(12-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.273g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.578 |
| Solubility: | Very soluble |
| Appearance: | cream to pale brown solid |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
