| Identification |
| Name: | Methanone,(4-nitrophenyl)phenyl- |
| Synonyms: | Benzophenone,4-nitro- (6CI,7CI,8CI);(4-Nitrophenyl)(phenyl)methanone;4-Nitrophenyl phenyl ketone;NSC 406623;p-Nitrobenzophenone;p-Nitrophenylphenyl ketone; |
| CAS: | 1144-74-7 |
| EINECS: | 214-542-2 |
| Molecular Formula: | C13H9NO3 |
| Molecular Weight: | 227.21 |
| InChI: | InChI=1/C13H9NO3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.266 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.614 |
| Solubility: | Insoluble |
| Appearance: | yellow to light brown fine crystalline powder |
| HS Code: | 29147090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
