| Identification | |
| Name: | Ethanedioic acid,1,2-bis(2,4,6-trichlorophenyl) ester |
| Synonyms: | Ethanedioicacid, bis(2,4,6-trichlorophenyl) ester (9CI);Oxalic acid,bis(2,4,6-trichlorophenyl) ester (7CI,8CI);Phenol, 2,4,6-trichloro-, oxalate(2:1) (8CI);Bis(2,4,6-trichlorophenyl) oxalate;Bis(2,4,6-trichlorophenyl)oxalic acid ester;TCPO (oxalate);bis(2,4,6-trichlorophenyl) ethanedioate;Bis(2,4,6-trichlorophenyl) oxalate;ethanedioic acid, bis(2,4,6-trichlorophenyl) ester;Bis(2,4,6-trichlorophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds]; |
| CAS: | 1165-91-9 |
| Molecular Formula: | C14H4Cl6O4 |
| Molecular Weight: | 448.90 |
| InChI: | InChI=1/C14H4Cl6O4/c15-5-1-7(17)11(8(18)2-5)23-13(21)14(22)24-12-9(19)3-6(16)4-10(12)20/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | 188 - 192 C |
| Flash Point: | 188-192 ºC |
| Density: | 1.698 |
| Refractive index: | 1.623 |
| Solubility: | |
| Appearance: | yellow to greenish crystalline powder |
| Flash Point: | 188-192 ºC |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
