| Identification | |
| Name: | Formamide,N-[1-[2-(formyloxy)ethyl]-1H-pyrazol-5-yl]- |
| Synonyms: | N-[1-[2-(Formyloxy)ethyl]-1H-pyrazol-5-yl]formamide;5-Formamido-1-(2-formyloxyethyl)-1H-pyrazole; |
| CAS: | 116856-18-9 |
| Molecular Formula: | C7H9N3O3 |
| Molecular Weight: | 183.16 |
| InChI: | InChI=1/C7H9N3O3/c11-5-8-7-1-2-9-10(7)3-4-13-6-12/h1-2,5-6H,3-4H2,(H,8,11) |
| Molecular Structure: | ![(C7H9N3O3) N-[1-[2-(Formyloxy)ethyl]-1H-pyrazol-5-yl]formamide;5-Formamido-1-(2-formyloxyethyl)-1H-pyrazole;](https://img.guidechem.com/casimg/116856-18-9.gif) |
| Properties | |
| Density: | 1.32 |
| Refractive index: | 1.572 |
| Appearance: | white powder |
| Specification: |
The IUPAC name of Formamide,N-[1-[2-(formyloxy)ethyl]-1H-pyrazol-5-yl]- is 2-(5-formamidopyrazol-1-yl)ethyl formate. With the CAS registry number 116856-18-9, it is also named as N-[1-[2-(Formyloxy)ethyl]-1H-pyrazol-5-yl]formamide. In addition, its molecular formula is C7H9N3O3 and its molecular weight is 183.16. The other characteristics of Formamide,N-[1-[2-(formyloxy)ethyl]-1H-pyrazol-5-yl]- can be summarized as: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 6.46; (5)ACD/KOC (pH 7.4): 6.46; (6)H bond acceptors: 6; (7)H bond donors: 1; (8)Freely Rotating Bonds: 5; (9)Polar Surface Area: 73.22 Å2; (10)Index of Refraction: 1.572; (11)Molar Refractivity: 45.41 cm3; (12)Molar Volume: 138 cm3; (13)Polarizability: 18×10-24cm3; (14)Surface Tension: 53.9 dyne/cm; (15)Density: 1.32 g/cm3; (16)Flash Point: 204.7 °C; (17)Melting point: 84-86 °C; (18)Enthalpy of Vaporization: 66.78 kJ/mol; (19)Boiling Point: 414.8 °C at 760 mmHg; (20)Vapour Pressure: 4.32E-07 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
