| Identification | |
| Name: | Benzene,1,2,4,5-tetrachloro-3-nitro- |
| Synonyms: | 1,2,4,5-Tetrachloro-3-nitrobenzene;1-Nitro-2,3,5,6-tetrachlorobenzene; 2,3,5,6-Tetrachloro-1-nitrobenzene; Chipman3142; Folosan; Folosan DB 905; Fusarex; Myfusan; NSC 10235; Napotate; Nebulin;TCNB; TCNB (pesticide); Tecnazen; Tecnazene; Tetrachloronitrobenzene |
| CAS: | 117-18-0 |
| EINECS: | 204-178-2 |
| Molecular Formula: | C6H Cl4 N O2 |
| Molecular Weight: | 260.88 |
| InChI: | InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 98-101 °C(lit.) |
| Flash Point: | 143.1°C |
| Boiling Point: | 304 °C(lit.) |
| Density: | 1.75g/cm3 |
| Refractive index: | 1.62 |
| Solubility: | READILY SOL IN CARBON DISULFIDE Soluble in ethanol, benzene, and chloroform In ethanol about 40 mg/L (25 deg C) /Tecnazene/ is readily soluble in ... ketones, and aromatic and chlorinated hydrocarbon compounds. It is practically insoluble in water (0.44 mg/l at 20 deg C) ... In water, 2.09 mg/L at 25 deg C |
| Specification: |
Tecnazene ,its cas register number is 117-18-0. It also can be called Fusarex ; Benzene, 1,2,4,5-tetrachloro-3-nitro ;and 1,2,4,5-Tetrachlor-3-nitrobenzol . When heated to decomposition it emits toxic fumes, and it may cause irritation on contact. |
| Flash Point: | 143.1°C |
| Storage Temperature: | 0-6°C |
| Color: | Colorless crystals |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
