| Identification | |
| Name: | Diphenylacetic acid |
| Synonyms: | 2,2-diphenylacetic acid;2,2-diphenylacetate;Acetic acid, diphenyl-;p-methoxyphenylaceticacid;Benzeneacetic acid, alpha-phenyl-;1,1-Diphenylacetic acid;Benzeneacetic acid, .alpha.-phenyl-;alpha-Toluic acid, alpha-phenyl-;Benzeneacetic acid,R-phenyl-; |
| CAS: | 117-34-0 |
| EINECS: | 204-185-0 |
| Molecular Formula: | C14H12O2 |
| Molecular Weight: | 212.24 |
| InChI: | InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.4°C |
| Boiling Point: | 195°C 25mm |
| Density: | 1.25 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.599 |
| Solubility: | Soluble |
| Appearance: | White crystals. |
| Specification: | white to creamy-white crystalline powder Safety Statements:24/25-36/37-26 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29163900 |
| Flash Point: | 140.4°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Nitrile as herbicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
