| Identification | ||
| Name: | 3,3',4',5,7-pentahydroxyflavone | |
| Synonyms: | 3,3,4,5,7-Pentahydroxyflavone (pract); Quercetin | |
| CAS: | 117-39-5 | |
| EINECS: | 204-187-1 | |
| Molecular Formula: | C15H10O7 | |
| Molecular Weight: | 302.24 | |
| InChI: | InChI=1/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 2811 | |
| Flash Point: | 248.1oC | |
| Boiling Point: | 642.4oCat 760 mmHg | |
| Density: | 1.799 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.767 | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Solubility: | <0.1 g/100 mL at 21 oC in water | |
| Appearance: | Yellow to green yellow crystalline powde | |
| Specification: |
Drug interactions of Quercetin (CAS NO.117-39-5):?It is contraindicated with some antibiotics; it may interact with fluoroquinolones (a type of medicinal antibiotic), as quercetin competitively binds to bacterial DNA gyrase. It is also a potent inhibitor of CYP3A4 and CYP2C9, which are enzymes that break down most drugs in the body. | |
| Packinggroup: | III | |
| Biological Activity: | Anti-tumor agent; induces apoptosis and inhibits synthesis of heat shock proteins. Inhibits many enzyme systems including tyrosine protein kinase, phospholipase A 2 , phosphodiesterases, mitochondrial ATPase, PI 3-kinase and protein kinase C. Can also activate Ca 2+ and K + channels and behaves as an agonist at estrogen (GPR30) receptors. | |
| Flash Point: | 248.1oC | |
| Color: | Yellow needles (dilute alcohol, +2 water) | |
| Usage: | Medication: quercetin & pentabenzyl ether deriv to decr capillary fragility prc: former use. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
